4-Benzoylphenyl acrylate|2-Propenoic acid|4-benzoylphenyl ester|CAS 22535-49-5

Synonyms: 2-propenoic acid (4-benzoylphenyl) ester; (4-benzoylphenyl) prop-2-enoate Molecular Weight: 252.26 Molecular Formula: C16H12O3 Canonical SMILES: C=CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 InChI: InChI=1S/C16H12O3/c1-2-15(17)19-14-10-8-13(9-11-14)16(18)12-6-4-3-5-7-12/h2-11H,1H2 InChI Key: LTYBJDPMCPTGEE-UHFFFAOYSA-N Boiling Point: 407ºC at760mmHg Purity: 98% Density: 1.163g/cm3
Categories: Polymer Additives
Product Name: 4-Benzoylphenyl acrylate|2-Propenoic acid|4-benzoylphenyl ester|CAS 22535-49-5
English Name: 2-Propenoic acid, 4-benzoylphenyl ester;2-Propenoic acid,4-benzoylphenyl ester;4-Acryloyloxybenzophenone;4-Acryloxybenzophenone;4-Benzoylphenyl acrylate;4-Benzoylphenyl acrylate fandachem;(4-benzoylphenyl)prop-2-enoate
CAS No.: 22535-49-5
Structural Formula: 4-Benzoylphenyl acrylate|2-Propenoic acid|4-benzoylphenyl ester|CAS 22535-49-5
MF:

C16H12O3

MW: 252.26
Appearance:
Purity: 98%
Application:

Prev:Uracil    

Online Order

Your name: *
Company name: *
Country:
Tel: *
Fax:
E-mail: *
Details: *
Verification code: